1-Naphthol-4-sulfonic acid structure
|
Common Name | 1-Naphthol-4-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 84-87-7 | Molecular Weight | 224.233 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 427ºC | |
| Molecular Formula | C10H8O4S | Melting Point | 170℃ | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Naphthol-4-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 427ºC |
| Melting Point | 170℃ |
| Molecular Formula | C10H8O4S |
| Molecular Weight | 224.233 |
| Exact Mass | 224.014328 |
| PSA | 82.98000 |
| LogP | -0.44 |
| Index of Refraction | 1.704 |
| InChIKey | HGWQOFDAUWCQDA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(O)c2ccccc12 |
| Hazard Codes | Xi,C |
|---|---|
| Risk Phrases | R34:Causes burns. |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 3261 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2908999090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Inhibition of human recombinant cathepsin B endopeptidase activity using Z-Arg-Arg-AM...
Source: ChEMBL
Target: Cathepsin B
External Id: CHEMBL2321257
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Inhibition of recombinant NDM-1 (unknown origin) using fluorocillin as substrate at 3...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5047076
|
|
Name: Inhibition of recombinant NDM-1 (unknown origin) using fluorocillin as substrate at 1...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5047075
|
|
Name: Inhibition of recombinant NDM-1 (unknown origin) using fluorocillin as substrate at 3...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5047074
|
| EINECS 201-568-4 |
| 4-Hydroxy-1-naphthalenesulfonic acid |
| 1-hydroxy-naphthalene-4-sulphonic acid |
| 1-naphthol-4-sulphonic acid |
| Neville and winther acid |
| 4-sulfonaphthol |
| 1-Naphthol-4-sulfoni |
| 1,4-Oxy Acid |
| 1-Naphthol-4-sulfonic acid |
| Nevile-Winthers acid |
| 1-hydroxy-4-naphthalenesulfonic acid |
| naphthalene 1-hydroxy-4-sulfonic acid |
| Neville acid |
| a-Naphthol-4-sulfonic acid |
| MFCD00065324 |
| 4-Hydroxynaphthalene-1-sulfonic acid |
| Nevile-Winther acid |
| HIGH-PURITY N.W. ACID |
| 1-oxynaphthalene-4-sulphonic acid |