1-Naphthol-4-sulfonic acid
1-Naphthol-4-sulfonic acid structure
|
Common Name | 1-Naphthol-4-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 84-87-7 | Molecular Weight | 224.233 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 427ºC | |
| Molecular Formula | C10H8O4S | Melting Point | 170℃ | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Naphthol-4-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 427ºC |
| Melting Point | 170℃ |
| Molecular Formula | C10H8O4S |
| Molecular Weight | 224.233 |
| Exact Mass | 224.014328 |
| PSA | 82.98000 |
| LogP | -0.44 |
| Index of Refraction | 1.704 |
| InChIKey | HGWQOFDAUWCQDA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(O)c2ccccc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi,C |
|---|---|
| Risk Phrases | R34:Causes burns. |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 3261 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2908999090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 10 | |
CAS#:567-18-0
CAS#:95-50-1
CAS#:90-15-3
CAS#:84-86-6
CAS#:162109-20-8
CAS#:6328-72-9
CAS#:3159-41-9![11-Oxabicyclo[4.4.1]undeca-1,3,5,7,9-pentaene Structure](https://image.chemsrc.com/caspic/242/4759-11-9.png)
CAS#:4759-11-9
CAS#:1857-16-5
CAS#:7757-83-7
CAS#:3567-69-9
CAS#:605-69-6
CAS#:114380-67-5
CAS#:130-15-4
CAS#:117-80-6
CAS#:239-01-0
CAS#:2065-37-4
CAS#:13243-65-7This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of human recombinant cathepsin B endopeptidase activity using Z-Arg-Arg-AM...
Source: ChEMBL
Target: Cathepsin B
External Id: CHEMBL2321257
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Inhibition of recombinant NDM-1 (unknown origin) using fluorocillin as substrate at 3...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5047076
|
|
Name: Inhibition of recombinant NDM-1 (unknown origin) using fluorocillin as substrate at 1...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5047075
|
|
Name: Inhibition of recombinant NDM-1 (unknown origin) using fluorocillin as substrate at 3...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5047074
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 201-568-4 |
| 4-Hydroxy-1-naphthalenesulfonic acid |
| 1-hydroxy-naphthalene-4-sulphonic acid |
| 1-naphthol-4-sulphonic acid |
| Neville and winther acid |
| 4-sulfonaphthol |
| 1-Naphthol-4-sulfoni |
| 1,4-Oxy Acid |
| 1-Naphthol-4-sulfonic acid |
| Nevile-Winthers acid |
| 1-hydroxy-4-naphthalenesulfonic acid |
| naphthalene 1-hydroxy-4-sulfonic acid |
| Neville acid |
| a-Naphthol-4-sulfonic acid |
| MFCD00065324 |
| 4-Hydroxynaphthalene-1-sulfonic acid |
| Nevile-Winther acid |
| HIGH-PURITY N.W. ACID |
| 1-oxynaphthalene-4-sulphonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 1-Naphthol-4-sulfonic acid? |
| A: Related upstream materials(CAS) of 1-Naphthol-4-sulfonic acid: 567-18-0;95-50-1;90-15-3;84-86-6;162109-20-8;6328-72-9;3159-41-9;4759-11-9;1857-16-5;7757-83-7. |
| Q: What is the InChIKey of 1-Naphthol-4-sulfonic acid? |
| A: InChIKey of 1-Naphthol-4-sulfonic acid is HGWQOFDAUWCQDA-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-Naphthol-4-sulfonic acid? |
| A: LogP of 1-Naphthol-4-sulfonic acid is -0.44. |
| Q: What is the English name of 1-Naphthol-4-sulfonic acid? |
| A: The English name of 1-Naphthol-4-sulfonic acid is 1-Naphthol-4-sulfonic acid. |
| Q: What are the downstream products of 1-Naphthol-4-sulfonic acid? |
| A: Related downstream products(CAS) of 1-Naphthol-4-sulfonic acid: 3567-69-9;605-69-6;90-15-3;114380-67-5;84-86-6;130-15-4;117-80-6;239-01-0;2065-37-4;13243-65-7. |
| Q: What is the molecular weight of 1-Naphthol-4-sulfonic acid? |
| A: Molecular weight of 1-Naphthol-4-sulfonic acid is 224.233. |
| Q: What is the polar surface area (PSA) of 1-Naphthol-4-sulfonic acid? |
| A: Polar surface area (PSA) of 1-Naphthol-4-sulfonic acid is 82.98000. |
| Q: What is the boiling point of 1-Naphthol-4-sulfonic acid? |
| A: Boiling point of 1-Naphthol-4-sulfonic acid is 427ºC. |
| Q: What is the safety information for 1-Naphthol-4-sulfonic acid? |
| A: Safety information for 1-Naphthol-4-sulfonic acid: S26-S36/37/39. |
| Q: What is the molecular formula of 1-Naphthol-4-sulfonic acid? |
| A: Molecular formula of 1-Naphthol-4-sulfonic acid is C10H8O4S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |