Naphthionic acid structure
|
Common Name | Naphthionic acid | ||
|---|---|---|---|---|
| CAS Number | 84-86-6 | Molecular Weight | 223.24800 | |
| Density | 1.67 | Boiling Point | 434ºC | |
| Molecular Formula | C10H9NO3S | Melting Point | ≥300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | naphthionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67 |
|---|---|
| Boiling Point | 434ºC |
| Melting Point | ≥300 °C(lit.) |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.24800 |
| Exact Mass | 223.03000 |
| PSA | 88.77000 |
| LogP | 3.33070 |
| Index of Refraction | 1.713 |
| InChIKey | NRZRRZAVMCAKEP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)O)c2ccccc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R22;R34 |
| Safety Phrases | S26-S36/37/39-S45-S25 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | 3 |
| RTECS | QK1270000 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 29214500 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921450090 |
|---|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Identification of [14C]carmoisine metabolites in bacterial suspension of rat faeces.
Food Addit. Contam. 7(1) , 1-7, (1990) An in vitro system consisting of a bacterial suspension of human or rat faecal microflora brought about the biological reduction of the red azo dye [14C]carmoisine to 1-naphthyl-amine-4-sulphonic acid... |
|
|
Synthetic organic food colouring agents and their degraded products: effects on human and rat cholinesterases.
Br. J. Biomed. Sci. 61(3) , 128-32, (2004) Most synthetic coloured additives are carcinogenic; teratogenic and cause allergic reactions. In this study, the effects of synthetic azo dyes (sunset yellow FCF and carmoisine), as well as their degr... |
|
|
Regiospecific O-methylation of naphthoic acids catalyzed by NcsB1, an O-methyltransferase involved in the biosynthesis of the enediyne antitumor antibiotic neocarzinostatin.
J. Biol. Chem. 283(21) , 14694-702, (2008) Neocarzinostatin, a clinical anticancer drug, is the archetypal member of the chromoprotein family of enediyne antitumor antibiotics that are composed of a nonprotein chromophore and an apoprotein. Th... |
| Naphthionic acid |
| EINECS 201-567-9 |
| MFCD00004027 |
| 4-Aminonaphthalene-1-sulfonic acid |