2,2,2,3’,5’-Pentafluoroacetophenone structure
|
Common Name | 2,2,2,3’,5’-Pentafluoroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 845823-12-3 | Molecular Weight | 210.101 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 173.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H3F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 62.7±20.1 °C | |
| Name | 1-(3,5-Difluorophenyl)-2,2,2-trifluoroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 173.4±35.0 °C at 760 mmHg |
| Molecular Formula | C8H3F5O |
| Molecular Weight | 210.101 |
| Flash Point | 62.7±20.1 °C |
| Exact Mass | 210.010406 |
| PSA | 17.07000 |
| LogP | 2.39 |
| Vapour Pressure | 1.3±0.3 mmHg at 25°C |
| Index of Refraction | 1.418 |
| InChIKey | VPJBBHOADBTNFQ-UHFFFAOYSA-N |
| SMILES | O=C(c1cc(F)cc(F)c1)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(3,5-Difluorophenyl)-2,2,2-trifluoroethanone |
| FXFFVR CF EF |
| Ethanone, 1-(3,5-difluorophenyl)-2,2,2-trifluoro- |
| 2,2,2,3’,5’-Pentafluoroacetophenone |