naphthalene-1,3,6-trisulphonic acid structure
|
Common Name | naphthalene-1,3,6-trisulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 86-66-8 | Molecular Weight | 368.36000 | |
| Density | 1.919g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O9S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalene-1,3,6-trisulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.919g/cm3 |
|---|---|
| Molecular Formula | C10H8O9S3 |
| Molecular Weight | 368.36000 |
| Exact Mass | 367.93300 |
| PSA | 188.25000 |
| LogP | 3.82230 |
| Index of Refraction | 1.714 |
| InChIKey | ZPBSAMLXSQCSOX-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Dissociation constant for Fibroblast growth factor 1
Source: ChEMBL
Target: Fibroblast growth factor 1
External Id: CHEMBL678684
|
|
Name: Binding affinity for Fibroblast growth factor 1
Source: ChEMBL
Target: Fibroblast growth factor 1
External Id: CHEMBL678686
|
|
Name: Dissociation constant for Fibroblast growth factor 2
Source: ChEMBL
Target: Fibroblast growth factor 2
External Id: CHEMBL678694
|
|
Name: Binding affinity for Fibroblast growth factor 2
Source: ChEMBL
Target: Fibroblast growth factor 2
External Id: CHEMBL677011
|
| Naphthalene-1,3,6-trisulfonic acid |
| Naphtalene-1,3,6-Trisulfonic Acid |
| 1,3,6-NAPHTHALENETRISULFONIC ACID |
| 2,5,7-Naphthalenetrisulfonic acid |
| Naphthalin-1,3,6-trisulfonsaeure |
| 1,3,6-NAPHTHALENETRISULFONICACID |
| naphthalene-1,3,6-trisulphonic acid |