6-(4-Iodophenyl)-6-oxohexanoic acid structure
|
Common Name | 6-(4-Iodophenyl)-6-oxohexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 854658-73-4 | Molecular Weight | 332.13400 | |
| Density | 1.63g/cm3 | Boiling Point | 462.3ºC at 760 mmHg | |
| Molecular Formula | C12H13IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | 6-(4-Iodophenyl)-6-oxohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 462.3ºC at 760 mmHg |
| Molecular Formula | C12H13IO3 |
| Molecular Weight | 332.13400 |
| Flash Point | 233.4ºC |
| Exact Mass | 331.99100 |
| PSA | 54.37000 |
| LogP | 3.11890 |
| Index of Refraction | 1.595 |
| InChIKey | XQGYDLUMTFGDSY-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCC(=O)c1ccc(I)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
6-(4-Iodophenyl... CAS#:854658-73-4 |
| Literature: Journal of the American Chemical Society, , vol. 64, p. 1436,1438 |
|
~%
6-(4-Iodophenyl... CAS#:854658-73-4 |
| Literature: Journal of the American Chemical Society, , vol. 64, p. 1436,1438 |
|
~%
6-(4-Iodophenyl... CAS#:854658-73-4 |
| Literature: Journal of the American Chemical Society, , vol. 64, p. 1436,1438 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-(4-iodo-phenyl)-6-oxo-hexanoic acid |
| 6-(4-Jod-phenyl)-6-oxo-hexansaeure |