(E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine
(E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine structure
|
Common Name | (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 85654-07-5 | Molecular Weight | 211.76300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14ClNSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 129.2 °F | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14ClNSi |
|---|---|
| Molecular Weight | 211.76300 |
| Exact Mass | 211.05800 |
| PSA | 12.36000 |
| LogP | 3.59380 |
| InChIKey | XLCRIROPKDZGLD-XYOKQWHBSA-N |
| SMILES | C[Si](C)(C)N=Cc1ccc(Cl)cc1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H228-H315-H319-H335 |
| Precautionary Statements | P210-P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RIDADR | UN1325 - class 4.1 - PG 3 - Flammable solids, organic, n.o.s., HI: all |
| Flash Point(F) | 129.2 °F |
| Flash Point(C) | 54 °C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~90%
(E)-1-(4-Chloro... CAS#:85654-07-5 |
| Literature: Vidal, Joelle; Damestoy, Stephanie; Guy, Laure; Hannachi, Jean-Christophe; Aubry, Andre; Collet, Andre Chemistry - A European Journal, 1997 , vol. 3, # 10 p. 1691 - 1709 |
|
~%
(E)-1-(4-Chloro... CAS#:85654-07-5 |
| Literature: Gyenes, Ferenc; Bergmann, Kathryn E.; Welch, John T. Journal of Organic Chemistry, 1998 , vol. 63, # 9 p. 2824 - 2828 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 2 | |
![methyl N-[(4-chlorophenyl)methylidene]carbamate structure](https://image.chemsrc.com/caspic/370/199604-20-1.png)
CAS#:199604-20-1
CAS#:74788-46-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-chlorobenzylidene)-N-(1,1,1-trimethylsilyl)amine |
| p-chlorobenzal-p'-phenitidine |
| (4-chlorobenzylidene)(4-ethoxyphenyl)amine |
| p-chlorobenzylidene-(4-ethoxyphenyl)-amine |
| R2 = 4-EtOC6H4 |
| N-(4-chlorobenzylidene)-4-ethoxyaniline |
| Benzenamine,N-[(4-chlorophenyl)methylene]-4-ethoxy |
| N-(4-chlorobenzylidene)-4-ethoxyphenylamine |
| (4-chlorobenzylidene)(trimethylsilanyl)amine |
| N-trimethylsilyl-p-chlorobenzaldimine |
| 4-Chlorbenzyliden-4'-ethoxyanilin |
| N-(4-chlorobenzylidene)-4-ethoxylaniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: Related downstream products(CAS) of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine: 199604-20-1;74788-46-8. |
| Q: What is the polar surface area (PSA) of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: Polar surface area (PSA) of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine is 12.36000. |
| Q: What are the upstream materials of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: Related upstream materials(CAS) of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine: 104-88-1;999-97-3;4039-32-1. |
| Q: What is the SMILES notation of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: SMILES notation of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine is C[Si](C)(C)N=Cc1ccc(Cl)cc1. |
| Q: What is the English name of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: The English name of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine is (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine. |
| Q: What is the InChIKey of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: InChIKey of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine is XLCRIROPKDZGLD-XYOKQWHBSA-N. |
| Q: What is the LogP of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: LogP of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine is 3.59380. |
| Q: What is the molecular formula of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: Molecular formula of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine is C10H14ClNSi. |
| Q: What is the molecular weight of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: Molecular weight of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine is 211.76300. |
| Q: What is the CAS number of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine? |
| A: CAS number of (E)-1-(4-Chlorophenyl)-N-(trimethylsilyl)methanimine is 85654-07-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |