Fmoc-D-Trp-OH structure
|
Common Name | Fmoc-D-Trp-OH | ||
|---|---|---|---|---|
| CAS Number | 86123-11-7 | Molecular Weight | 426.464 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 711.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C26H22N2O4 | Melting Point | 182-185ºC | |
| MSDS | Chinese USA | Flash Point | 384.3±32.9 °C | |
| Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 711.9±60.0 °C at 760 mmHg |
| Melting Point | 182-185ºC |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.464 |
| Flash Point | 384.3±32.9 °C |
| Exact Mass | 426.157959 |
| PSA | 91.42000 |
| LogP | 5.33 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.690 |
| InChIKey | MGHMWKZOLAAOTD-XMMPIXPASA-N |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| FMOC-D-TRP |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-tryptophan |
| Na-(9-Fluorenylmethoxycarbonyl)-D-tryptophan |
| D-Tryptophan, N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-D-Trp-OH |
| N-Fmoc-D-tryptophan |
| Nalpha-(9-Fluorenylmethoxycarbonyl)-D-tryptophan |
| MFCD00062954 |
| Fmoc-D-tryptophan |
| N-Fmoc-D-Trp-OH |