(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol structure
|
Common Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol | ||
|---|---|---|---|---|
| CAS Number | 86234-44-8 | Molecular Weight | 553.60800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H31N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H31N5O5 |
|---|---|
| Molecular Weight | 553.60800 |
| Exact Mass | 553.23300 |
| PSA | 126.77000 |
| LogP | 4.66400 |
| InChIKey | NOBMIXQDCWEUCH-LUXHBGHRSA-N |
| SMILES | COc1ccc(C(OCC2CC(O)C(n3cnc4c(N)ncnc43)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol? |
| A: Related downstream products(CAS) of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol: 84138-86-3. |
| Q: What is the InChIKey of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol? |
| A: InChIKey of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol is NOBMIXQDCWEUCH-LUXHBGHRSA-N. |
| Q: What is the SMILES notation of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol? |
| A: SMILES notation of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol is COc1ccc(C(OCC2CC(O)C(n3cnc4c(N)ncnc43)O2)(c2ccccc2)c2ccc(OC)cc2)cc1. |
| Q: What is the LogP of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol? |
| A: LogP of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol is 4.66400. |
| Q: What is the CAS number of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol? |
| A: CAS number of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol is 86234-44-8. |
| Q: What is the Chinese name of 86234-44-8? |
| A: Chinese name of 86234-44-8 is 86234-44-8. |
| Q: What is the molecular weight of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol? |
| A: Molecular weight of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol is 553.60800. |
| Q: What is the molecular formula of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol? |
| A: Molecular formula of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol is C31H31N5O5. |
| Q: What is the English name of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol? |
| A: The English name of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol is (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol. |
| Q: What is the polar surface area (PSA) of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol? |
| A: Polar surface area (PSA) of (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-ol is 126.77000. |