alpha-Amyrin acetate structure
|
Common Name | alpha-Amyrin acetate | ||
|---|---|---|---|---|
| CAS Number | 863-76-3 | Molecular Weight | 468.75 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 508.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C32H52O2 | Melting Point | 241ºC | |
| MSDS | N/A | Flash Point | 258.0±17.7 °C | |
Use of alpha-Amyrin acetateα-Amyrin acetate, a natural triterpenoid, has anti-inflammatory activity, antispasmodic profile and the relaxant effect[1][2]. |
| Name | (4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Description | α-Amyrin acetate, a natural triterpenoid, has anti-inflammatory activity, antispasmodic profile and the relaxant effect[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 508.0±50.0 °C at 760 mmHg |
| Melting Point | 241ºC |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.75 |
| Flash Point | 258.0±17.7 °C |
| Exact Mass | 468.396729 |
| PSA | 26.30000 |
| LogP | 11.90 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | UDXDFWBZZQHDRO-NSTYLNEOSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4C(C)C(C)CCC4(C)CCC23C)C1(C)C |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Urs-12-en-3β-ol, acetate |
| Urs-12-en-3-ol, acetate, (3β)- |
| Acetic acid,4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydro-picen-3-yl ester |
| Urs-12-en-3β-ol, acetate (8CI) |
| (3β)-Urs-12-en-3-yl acetate |
| 4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl acetate |
| α-Amyrin acetate |
| Urs-12-en-3-yl acetate |