1H,1H,2H,2H-Perfluorodecylamine structure
|
Common Name | 1H,1H,2H,2H-Perfluorodecylamine | ||
|---|---|---|---|---|
| CAS Number | 30670-30-5 | Molecular Weight | 463.13400 | |
| Density | 1.595g/cm3 | Boiling Point | 182.9ºC at 760mmHg | |
| Molecular Formula | C10H6F17N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 74.1ºC | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.595g/cm3 |
|---|---|
| Boiling Point | 182.9ºC at 760mmHg |
| Molecular Formula | C10H6F17N |
| Molecular Weight | 463.13400 |
| Flash Point | 74.1ºC |
| Exact Mass | 463.02300 |
| PSA | 26.02000 |
| LogP | 6.04490 |
| Index of Refraction | 1.3 |
| InChIKey | PFINVJYJNJHTFY-UHFFFAOYSA-N |
| SMILES | NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2921199090 |
|
~98%
1H,1H,2H,2H-Per... CAS#:30670-30-5 |
| Literature: Perino, Sandrine; Contino-Pepin, Christiane; Jasseron, Sylvain; Rapp, Maryse; Maurizis, Jean-Claude; Pucci, Bernard Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 5 p. 1111 - 1114 |
|
~%
1H,1H,2H,2H-Per... CAS#:30670-30-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 25, # 5 p. 539 - 544 |
|
~%
1H,1H,2H,2H-Per... CAS#:30670-30-5 |
| Literature: US4719312 A1, ; |
|
~%
1H,1H,2H,2H-Per... CAS#:30670-30-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 25, # 5 p. 539 - 544 |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,1,2,2-tetrahydroperfluoro-decyl amine |
| 2-(perfluorooctyl)ethylamine |
| 10-amino-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane |
| 1-amino-1H,1H,2H,2H-perfluorodecane |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylamine |
| 1H,1H,2H,2H-Perfluorodecylamine |