Benzyl-PEG6-azide structure
|
Common Name | Benzyl-PEG6-azide | ||
|---|---|---|---|---|
| CAS Number | 86770-73-2 | Molecular Weight | 397.46600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H31N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Benzyl-PEG6-azideBenzyl-PEG6-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 19-azido-1-phenyl-2,5,8,11,14,17-hexaoxanonadecane |
|---|---|
| Synonym | More Synonyms |
| Description | Benzyl-PEG6-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H31N3O6 |
|---|---|
| Molecular Weight | 397.46600 |
| Exact Mass | 397.22100 |
| PSA | 105.13000 |
| LogP | 2.04926 |
| InChIKey | TYGXSSHTJLZOIG-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCc1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Benzyl-PEG6-azide |