threo-Guaiacylglycerol beta-coniferyl ether
Modify Date: 2025-08-25 22:52:04
threo-Guaiacylglycerol beta-coniferyl ether structure
|
Common Name | threo-Guaiacylglycerol beta-coniferyl ether | ||
|---|---|---|---|---|
| CAS Number | 869799-76-8 | Molecular Weight | 376.40 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 643.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H24O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.8±31.5 °C | |
Use of threo-Guaiacylglycerol beta-coniferyl etherthreo-Guaiacylglycerol beta-coniferyl ether is a lignan that can inhibit NO production. threo-Guaiacylglycerol beta-coniferyl ether exhibits anti-neuroinflammatory activities[1]. |
| Name | (1R,2R)-1-(4-Hydroxy-3-methoxyphenyl)-2-{4-[(1E)-3-hydroxy-1-prop en-1-yl]-2-methoxyphenoxy}-1,3-propanediol |
|---|---|
| Synonym | More Synonyms |
| Description | threo-Guaiacylglycerol beta-coniferyl ether is a lignan that can inhibit NO production. threo-Guaiacylglycerol beta-coniferyl ether exhibits anti-neuroinflammatory activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 643.2±55.0 °C at 760 mmHg |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.40 |
| Flash Point | 342.8±31.5 °C |
| Exact Mass | 376.152191 |
| PSA | 108.61000 |
| LogP | 0.65 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | FYEZJIXULOZDRT-WOJBJXKFSA-N |
| SMILES | COc1cc(C(O)C(CO)Oc2ccc(C=CCO)cc2OC)ccc1O |
| Hazard Codes | Xi |
|---|
| 1,3-Propanediol, 1-(4-hydroxy-3-methoxyphenyl)-2-[4-[(1E)-3-hydroxy-1-propen-1-yl]-2-methoxyphenoxy]-, (1R,2R)- |
| (1R,2R)-1-(4-Hydroxy-3-methoxyphenyl)-2-{4-[(1E)-3-hydroxy-1-propen-1-yl]-2-methoxyphenoxy}-1,3-propanediol |