violuric acid structure
|
Common Name | violuric acid | ||
|---|---|---|---|---|
| CAS Number | 87-39-8 | Molecular Weight | 157.08400 | |
| Density | 2.19 g/cm3 | Boiling Point | 494.1ºCat 760 mmHg | |
| Molecular Formula | C4H3N3O4 | Melting Point | 240-250 °C (dec.) | |
| MSDS | N/A | Flash Point | 252.6ºC | |
Use of violuric acidVioluric acid is a redox mediator used in the laccase system. The violuric acid assay is a method to ascertain that the high-redox potential of laccase is not lost during directed evolution[1][2]. |
| Name | Violuric Acid Monohydrate |
|---|---|
| Synonym | More Synonyms |
| Description | Violuric acid is a redox mediator used in the laccase system. The violuric acid assay is a method to ascertain that the high-redox potential of laccase is not lost during directed evolution[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.19 g/cm3 |
|---|---|
| Boiling Point | 494.1ºCat 760 mmHg |
| Melting Point | 240-250 °C (dec.) |
| Molecular Formula | C4H3N3O4 |
| Molecular Weight | 157.08400 |
| Flash Point | 252.6ºC |
| Exact Mass | 157.01200 |
| PSA | 107.86000 |
| Index of Refraction | 1.813 |
| InChIKey | HRRVLSKRYVIEPR-UHFFFAOYSA-N |
| SMILES | O=Nc1c(O)[nH]c(=O)[nH]c1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| violuric acid |
| MFCD00006032 |
| EINECS 201-741-4 |