Chloranilic acid structure
|
Common Name | Chloranilic acid | ||
|---|---|---|---|---|
| CAS Number | 87-88-7 | Molecular Weight | 208.984 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 300.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H2Cl2O4 | Melting Point | ≥300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 135.4±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | chloranilic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.3±42.0 °C at 760 mmHg |
| Melting Point | ≥300 °C(lit.) |
| Molecular Formula | C6H2Cl2O4 |
| Molecular Weight | 208.984 |
| Flash Point | 135.4±27.9 °C |
| Exact Mass | 207.933014 |
| PSA | 74.60000 |
| LogP | 0.18 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | IPPWILKGXFOXHO-UHFFFAOYSA-N |
| SMILES | O=C1C(O)=C(Cl)C(=O)C(O)=C1Cl |
| Storage condition | Amber Vial, Refrigerator |
| Stability | Stable. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DK4005000 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| chloranilic |
| 2.5-dichloro-3.6-dihydroxy-1,4-benzoquinone |
| EINECS 201-780-7 |
| 2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione |
| p-chloranilicacid |
| 2,5-Dichloro-3,6-dihydroxy-p-quinone |
| 2,5-Dichloro-3,6-dihydroxy-1,4-benzoquinone |
| 2,5-Dichloro-3,6-dihydroxy-2,5-cyclohexadiene-1,4-dione |
| Chloranilic acid |
| MFCD00001596 |