Isolindleyin structure
|
Common Name | Isolindleyin | ||
|---|---|---|---|---|
| CAS Number | 87075-18-1 | Molecular Weight | 478.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IsolindleyinIsolindleyin, a butyrophenone, is a tyrosinase inhibitor, with a Kd of 54.8 μM for human tyrosinase. Isolindleyin exhibits anti-inflammatory, analgesic and anti-melanogenic activities[1]. |
| Name | Isolindleyin |
|---|---|
| Synonym | More Synonyms |
| Description | Isolindleyin, a butyrophenone, is a tyrosinase inhibitor, with a Kd of 54.8 μM for human tyrosinase. Isolindleyin exhibits anti-inflammatory, analgesic and anti-melanogenic activities[1]. |
|---|---|
| Related Catalog | |
| Target |
Kd: 54.8 μM (human tyrosinase)[1] |
| In Vitro | Isolindley (1-500 μM; 7 days) suppresses melanin synthesis in human epidermal melanocytes[1]. |
| References |
| Molecular Formula | C23H26O11 |
|---|---|
| Molecular Weight | 478.44600 |
| Exact Mass | 478.14800 |
| PSA | 183.21000 |
| LogP | 0.36840 |
| InChIKey | KHUVRRVIZOSFTI-UHFFFAOYSA-N |
| SMILES | CC(=O)CCc1ccc(OC2OC(CO)C(O)C(O)C2OC(=O)c2cc(O)c(O)c(O)c2)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 4-(4'-hydroxyphenyl)-2-butanone 4'-O-β-D-(2-O-galloyl)-glycopyranoside |