Kelampayoside A structure
|
Common Name | Kelampayoside A | ||
|---|---|---|---|---|
| CAS Number | 87562-76-3 | Molecular Weight | 478.44 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 735.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 398.9±32.9 °C | |
Use of Kelampayoside AKelampayoside A, a natural compound, shows an EC50 value of 35.7 µg/mL in DPPH assay (antioxidative activity)[1]. |
| Name | 3,4,5-Trimethoxyphenyl 6-O-[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxyme thyl)tetrahydro-2-furanyl]-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Kelampayoside A, a natural compound, shows an EC50 value of 35.7 µg/mL in DPPH assay (antioxidative activity)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 735.9±60.0 °C at 760 mmHg |
| Molecular Formula | C20H30O13 |
| Molecular Weight | 478.44 |
| Flash Point | 398.9±32.9 °C |
| Exact Mass | 478.168640 |
| PSA | 185.99000 |
| LogP | -0.68 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | CKGKQISENBKOCA-FHXQZXMCSA-N |
| SMILES | COc1cc(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O)cc(OC)c1OC |
| Hazard Codes | Xi |
|---|
| 3,4,5-Trimethoxyphenyl 6-O-[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydro-2-furanyl]-β-D-glucopyranoside |
| β-D-Glucopyranoside, 3,4,5-trimethoxyphenyl 6-O-[(2R,3R,4R)-tetrahydro-3,4-dihydroxy-4-(hydroxymethyl)-2-furanyl]- |
| 3,4,5-Trimethoxy-phenoxyessigsaeure |
| kelampayoside A |