ethyl N-[4-(1,3-oxathiolan-2-yl)phenyl]carbamate structure
|
Common Name | ethyl N-[4-(1,3-oxathiolan-2-yl)phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 87623-14-1 | Molecular Weight | 253.31700 | |
| Density | 1.27g/cm3 | Boiling Point | 363.5ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.6ºC | |
| Name | ethyl N-[4-(1,3-oxathiolan-2-yl)phenyl]carbamate |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760 mmHg |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.31700 |
| Flash Point | 173.6ºC |
| Exact Mass | 253.07700 |
| PSA | 72.86000 |
| LogP | 3.09000 |
| Index of Refraction | 1.605 |
| InChIKey | HIOPJDRYJSGLRB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(C2OCCS2)cc1 |
|
~80%
ethyl N-[4-(1,3... CAS#:87623-14-1 |
| Literature: Witek, Stanislaw; Bielawski, Jacek; Bielawska, Alicja Polish Journal of Chemistry, 1981 , vol. 55, # 11 p. 2315 - 2326 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |