PSNCBAM-1 structure
|
Common Name | PSNCBAM-1 | ||
|---|---|---|---|---|
| CAS Number | 877202-74-9 | Molecular Weight | 392.88100 | |
| Density | N/A | Boiling Point | 521.5±50.0 °C(Predicted) | |
| Molecular Formula | C22H21ClN4O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of PSNCBAM-1PSNCBAM-1 is a selective CB1 receptor allosteric antagonist with an EC50 of 0.1 μM. PSNCBAM-1 can be used in the researches of obesity[1]. |
| Name | Urea, N-(4-chlorophenyl)-N'-[3-[6-(1-pyrrolidinyl)-2-pyridinyl]phenyl] |
|---|---|
| Synonym | More Synonyms |
| Description | PSNCBAM-1 is a selective CB1 receptor allosteric antagonist with an EC50 of 0.1 μM. PSNCBAM-1 can be used in the researches of obesity[1]. |
|---|---|
| Related Catalog | |
| Target |
hCB1-R:0.1 μM (EC50) |
| References |
| Boiling Point | 521.5±50.0 °C(Predicted) |
|---|---|
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.88100 |
| Exact Mass | 392.14000 |
| PSA | 57.26000 |
| LogP | 5.85720 |
| InChIKey | HDAYFSFWIPRJSO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cccc(-c2cccc(N3CCCC3)n2)c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| PSNCBAM 1 |
| 1-(4-Chlorophenyl)-3-[3-[6-(pyrrolidin-1-yl)pyridin-2-yl]phenyl]urea |