INI-43
Modify Date: 2025-09-12 11:44:34
INI-43 structure
|
Common Name | INI-43 | ||
|---|---|---|---|---|
| CAS Number | 881046-01-1 | Molecular Weight | 385.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23N7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of INI-43INI-43, a Kpnβ1 inhibitor, interferes with the nuclear localization of Kpnβ1 and known Kpnβ1 cargoes, NFAT, NFκB, AP-1 and NFY[1]. |
| Name | INI-43 |
|---|
| Description | INI-43, a Kpnβ1 inhibitor, interferes with the nuclear localization of Kpnβ1 and known Kpnβ1 cargoes, NFAT, NFκB, AP-1 and NFY[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H23N7 |
|---|---|
| Molecular Weight | 385.46 |
| InChIKey | LWPQQQAILAUWTI-UHFFFAOYSA-N |
| SMILES | CN(C)CCCn1c(N)c(-c2nc3ccccc3[nH]2)c2nc3ccccc3nc21 |