Boc-L-Ala-OH-d structure
|
Common Name | Boc-L-Ala-OH-d | ||
|---|---|---|---|---|
| CAS Number | 88181-11-7 | Molecular Weight | 190.22 | |
| Density | 1.133 g/cm3 | Boiling Point | 320.912ºC at 760 mmHg | |
| Molecular Formula | C8H14DNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.883ºC | |
Use of Boc-L-Ala-OH-dBoc-L-Ala-OH-d is the deuterium labeled Boc-L-Ala-OH[1]. |
| Name | l-alanine-2-d1-n-t-boc |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-L-Ala-OH-d is the deuterium labeled Boc-L-Ala-OH[1]. |
|---|---|
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.133 g/cm3 |
|---|---|
| Boiling Point | 320.912ºC at 760 mmHg |
| Molecular Formula | C8H14DNO4 |
| Molecular Weight | 190.22 |
| Flash Point | 147.883ºC |
| Exact Mass | 190.10600 |
| PSA | 75.63000 |
| LogP | 1.37510 |
| InChIKey | QVHJQCGUWFKTSE-VXNMYXNSSA-N |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)O |
|
~63%
Boc-L-Ala-OH-d CAS#:88181-11-7 |
| Literature: Oboodi, M. Reza; Alva, Carlos; Diem, Max Journal of Physical Chemistry, 1984 , vol. 88, # 3 p. 501 - 505 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| tert-butyloxycarbonyl-D-valine |
| t-Boc-L-alanine-2-d1 |
| tBoc-DVal-OH |
| (R)-Boc-Val-OH |
| Boc-L-Val-OH |
| N-t-butyloxycarbonyl-D-valine |
| Boc-L-<2-(2)H>alanine |
| N-(tert-Butoxycarbonyl)-D-valine |
| N-(tert-butoxycarbonyl)-L-alanine-d1 |
| Boc-D-Val-OH |
| Boc-D-valine |