DPDPE structure
|
Common Name | DPDPE | ||
|---|---|---|---|---|
| CAS Number | 88373-73-3 | Molecular Weight | 645.790 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1038.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C30H39N5O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 581.9±34.3 °C | |
Use of DPDPEDPDPE, an opioid peptide, is a selective δ-opioid receptor (DOR) agonist with anticonvulsant effects[1]. |
| Name | 13-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-7-benzyl-3,3,14,14-tetramethyl-6,9,12-trioxo-1,2-dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | DPDPE, an opioid peptide, is a selective δ-opioid receptor (DOR) agonist with anticonvulsant effects[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1038.6±65.0 °C at 760 mmHg |
| Molecular Formula | C30H39N5O7S2 |
| Molecular Weight | 645.790 |
| Flash Point | 581.9±34.3 °C |
| Exact Mass | 645.229065 |
| PSA | 250.55000 |
| LogP | 2.24 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | MCMMCRYPQBNCPH-WMIMKTLMSA-N |
| SMILES | CC1(C)SSC(C)(C)C(NC(=O)C(N)Cc2ccc(O)cc2)C(=O)NCC(=O)NC(Cc2ccccc2)C(=O)NC1C(=O)O |
| Storage condition | -20°C |
| WGK Germany | 3 |
|---|
|
~64%
DPDPE CAS#:88373-73-3 |
| Literature: Maruyama, Toshihiro; Ikeo, Takayoshi; Ueki, Masaaki Tetrahedron Letters, 1999 , vol. 40, # 27 p. 5031 - 5034 |
|
~%
Detail
|
| Literature: Journal of the American Chemical Society, , vol. 118, # 31 p. 7280 - 7290 |
| c[D-Pen2,5]-enkephalin |
| [D-Pen(2),D-Pen(5)]enkephalin |
| 8-(3-Chlorostyryl)caffeine |
| 1,2-Dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid, 13-[[(2S)-2-amino-3-(4-hydroxyphenyl)-1-oxopropyl]amino]-3,3,14,14-tetramethyl-6,9,12-trioxo-7-(phenylmethyl)-, (4S,7S,13S)- |
| Tyr-D-Pen-Gly-Phe-D-Pen |
| (4S,7S,13S)-7-Benzyl-3,3,14,14-tetramethyl-6,9,12-trioxo-13-(L-tyrosylamino)-1,2-dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid |
| H-Tyr-c(D-Pen-Gly-Phe-D-Pen)-OH |
| DPDPE |
| 13-[2-amino-3-(4-hydroxyphenyl)propanamido]-7-benzyl-3,3,14,14-tetramethyl-6,9,12-trioxo-1,2-dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid |
| 1,2-Dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid, 13-[[(2S)-2-amino-3-(4-hydroxyphenyl)-1-oxopropyl]amino]-3,3,14,14-tetramethyl-6,9,12-trioxo-7-(phenylmethyl)-, (4R,7S,13R)- |
| Tyr-c[D-Pen-Gly-Phe-D-Pen]OH |
| (4R,7S,13R)-7-Benzyl-3,3,14,14-tetramethyl-6,9,12-trioxo-13-(L-tyrosylamino)-1,2-dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid |
| [D-Pen2,5]-ENKEPHALIN |
| [D-Pen2-D-Pen5]-enkephaline |
| c[D-Pen(2)-D-Pen(5)]enkephalin |