trimethyl-(2-oxo-2-phenylmethoxyethyl)azanium,bromide structure
|
Common Name | trimethyl-(2-oxo-2-phenylmethoxyethyl)azanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 88390-01-6 | Molecular Weight | 288.18100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2-oxo-2-phenylmethoxyethyl)azanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18BrNO2 |
|---|---|
| Molecular Weight | 288.18100 |
| Exact Mass | 287.05200 |
| PSA | 26.30000 |
| InChIKey | ABWCCVSEYCOCQH-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC(=O)OCc1ccccc1.[Br-] |
|
~%
trimethyl-(2-ox... CAS#:88390-01-6 |
| Literature: Renshaw; Hotchkiss Journal of the American Chemical Society, 1926 , vol. 48, p. 2701 |
|
~47%
trimethyl-(2-ox... CAS#:88390-01-6 |
| Literature: Wittmann, Helga; Ziegler, Erich Monatshefte fuer Chemie, 1988 , vol. 119, p. 103 - 112 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| Trimethylammoniumessigsaeurebetain-benzylester-bromid |
| benzyloxycarbonylmethyl-trimethyl-ammonium,bromide |
| Benzyloxycarbonylmethyl-trimethyl-ammonium,Bromid |