Methyl 4-hydroxy-3,5-dimethoxybenzoate structure
|
Common Name | Methyl 4-hydroxy-3,5-dimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 884-35-5 | Molecular Weight | 212.199 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 339.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H12O5 | Melting Point | 103-107 °C | |
| MSDS | N/A | Flash Point | 132.4±20.0 °C | |
Use of Methyl 4-hydroxy-3,5-dimethoxybenzoateMethyl syringate, a chemical marker of asphodel monofloral honey, is an efficient phenolic mediator for bacterial and fungal laccases. Methyl syringate is a TRPA1 agonist[1][2][3]. |
| Name | methyl syringate |
|---|---|
| Synonym | More Synonyms |
| Description | Methyl syringate, a chemical marker of asphodel monofloral honey, is an efficient phenolic mediator for bacterial and fungal laccases. Methyl syringate is a TRPA1 agonist[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
TRPA1[3]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.9±37.0 °C at 760 mmHg |
| Melting Point | 103-107 °C |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.199 |
| Flash Point | 132.4±20.0 °C |
| Exact Mass | 212.068466 |
| PSA | 64.99000 |
| LogP | 1.10 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | ZMXJAEGJWHJMGX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c(O)c(OC)c1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| HS Code | 2918990090 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Antifeedant activity against Hylobius abietis (pine weevil ) in compound pre-treated ...
Source: ChEMBL
Target: Hylobius abietis
External Id: CHEMBL3051815
|
| Methyl syringate |
| Methyl 4-hydroxy-3,5-dimethoxybenzoate |
| MFCD00017199 |
| EINECS 429-050-5 |
| Benzoic acid, 4-hydroxy-3,5-dimethoxy-, methyl ester |
| Syringic acid methyl ester |
| 1OVR DQ CO1 EO1 |