N-(3-Boc-Aminomethylphenyl)-n-(4-methoxyphenyl)amine structure
|
Common Name | N-(3-Boc-Aminomethylphenyl)-n-(4-methoxyphenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 886362-41-0 | Molecular Weight | 328.40500 | |
| Density | 1.129g/cm3 | Boiling Point | 492.3ºC at 760 mmHg | |
| Molecular Formula | C19H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | tert-butyl N-[[3-(4-methoxyanilino)phenyl]methyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760 mmHg |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.40500 |
| Flash Point | 251.5ºC |
| Exact Mass | 328.17900 |
| PSA | 59.59000 |
| LogP | 4.92740 |
| Index of Refraction | 1.572 |
| InChIKey | LYVLWSFASSRLJT-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2cccc(CNC(=O)OC(C)(C)C)c2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3-Boc-Aminomethylphenyl)-N-(4-Methoxyphenyl)Amine |
| [3-(4-methoxy-phenylamino)-benzyl]-carbamic acid tert-butyl ester |
| tert-Butyl 3-((4-methoxyphenyl)amino)benzylcarbamate |
| N-(3-Boc-aminomethylphenyl)-N-(4 |