PEG9-Tos structure
|
Common Name | PEG9-Tos | ||
|---|---|---|---|---|
| CAS Number | 886469-23-4 | Molecular Weight | 524.622 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 615.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H40O11S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.8±31.5 °C | |
Use of PEG9-TosPEG8-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | PEG8-Ts |
|---|---|
| Synonym | More Synonyms |
| Description | PEG8-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 615.0±55.0 °C at 760 mmHg |
| Molecular Formula | C23H40O11S |
| Molecular Weight | 524.622 |
| Flash Point | 325.8±31.5 °C |
| Exact Mass | 524.229126 |
| LogP | -1.56 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | WJRLJFKBPYKOHJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCO)cc1 |
| 23-Hydroxy-3,6,9,12,15,18,21-heptaoxatricos-1-yl 4-methylbenzenesulfonate |
| PEG8-Ts |
| 3,6,9,12,15,18,21-Heptaoxatricosane-1,23-diol, mono(4-methylbenzenesulfonate) |
| PEG8-OTs |