m-PEG8-Tos structure
|
Common Name | m-PEG8-Tos | ||
|---|---|---|---|---|
| CAS Number | 82217-01-4 | Molecular Weight | 538.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H42O11S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG8-TosTos-PEG8-m is a derivative of silybin ethers, extracted from patent CN105037337A (compound III-d). Tos-PEG8-m is a PEG-based PROTAC linker can be used in the synthesis of Silymarin (HY-W043277)[1]. |
| Name | m-PEG9-Tos |
|---|
| Description | Tos-PEG8-m is a derivative of silybin ethers, extracted from patent CN105037337A (compound III-d). Tos-PEG8-m is a PEG-based PROTAC linker can be used in the synthesis of Silymarin (HY-W043277)[1]. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C24H42O11S |
|---|---|
| Molecular Weight | 538.65 |
| InChIKey | PAXJFLMMCORNQI-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOS(=O)(=O)c1ccc(C)cc1 |
| Storage condition | 2-8°C |