11,12-Dihydroxyabieta-8(14),9(11),12-trien-7-one structure
|
Common Name | 11,12-Dihydroxyabieta-8(14),9(11),12-trien-7-one | ||
|---|---|---|---|---|
| CAS Number | 88664-08-8 | Molecular Weight | 316.43 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 482.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H28O3 | Melting Point | 192-194 °C | |
| MSDS | N/A | Flash Point | 259.5±25.2 °C | |
Use of 11,12-Dihydroxyabieta-8(14),9(11),12-trien-7-one11-Hydroxysugiol regulates the SUMOylation of intracellular receptors by modulating RARα and vitamin D3 receptor (VDR)[1]. |
| Name | 11,12-dihydroxyabieta-8,11,13-trien-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | 11-Hydroxysugiol regulates the SUMOylation of intracellular receptors by modulating RARα and vitamin D3 receptor (VDR)[1]. |
|---|---|
| Related Catalog | |
| Target |
RARα |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 482.2±45.0 °C at 760 mmHg |
| Melting Point | 192-194 °C |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.43 |
| Flash Point | 259.5±25.2 °C |
| Exact Mass | 316.203857 |
| PSA | 57.53000 |
| LogP | 6.63 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | GDLRDIDXYBIPFY-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc2c(c(O)c1O)C1(C)CCCC(C)(C)C1CC2=O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| 9(1H)-Phenanthrenone, 2,3,4,4a,10,10a-hexahydro-5,6-dihydroxy-1,1,4a-trimethyl-7-(1-methylethyl)-, (4aS,10aS)- |
| 12-O-DEMETHYLCRYPTOJAPANOL |
| 11,12-Dihydroxyabieta-8(14),9(11),12-trien-7-one |
| 11-Hydroxysugiol |
| 11-hydroxy-sugiol |