Mogroside III-A1 structure
|
Common Name | Mogroside III-A1 | ||
|---|---|---|---|---|
| CAS Number | 88901-42-2 | Molecular Weight | 963.153 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1059.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C48H82O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 594.6±34.3 °C | |
Use of Mogroside III-A1Mogroside III-A1, a triterpenoid glycoside isolated from the extracts of Luo Han Guo, is a nonsugar sweetener. Mogrosides are sweeter than sucrose. Mogrosides exhibit antioxidant, antidiabetic and anticancer activities[1]. |
| Name | β-D-Glucopyranoside, (3β,9β,10α,11α,24R)-3,11,25-trihydroxy-9-methyl-19-norlanost-5-en-24-yl O-β-D-glucopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→6)] |
|---|---|
| Synonym | More Synonyms |
| Description | Mogroside III-A1, a triterpenoid glycoside isolated from the extracts of Luo Han Guo, is a nonsugar sweetener. Mogrosides are sweeter than sucrose. Mogrosides exhibit antioxidant, antidiabetic and anticancer activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1059.6±65.0 °C at 760 mmHg |
| Molecular Formula | C48H82O19 |
| Molecular Weight | 963.153 |
| Flash Point | 594.6±34.3 °C |
| Exact Mass | 962.545044 |
| PSA | 318.37000 |
| LogP | 1.18 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | DDDXYRAMQRKPDO-UHFFFAOYSA-N |
| SMILES | CC(CCC(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(C)(C)O)C1CCC2(C)C3CC=C4C(CCC(O)C4(C)C)C3(C)C(O)CC12C |
| Mogroside IIIA1 |
| (1S,4R,9β,11α,24R)-1,11,25-Trihydroxy-9,10,14-trimethyl-4,9-cyclo-9,10-secocholest-5-en-24-yl β-D-glucopyranosyl-(1->2)-[β-D-glucopyranosyl-(1->6)]-β-D-glucopyranoside |
| Mogroside ⅢA1 |
| Mogroside-IIIA1 |
| (1S,4R,9β,11α,17ξ,24R)-1,11,25-Trihydroxy-9,10,14-trimethyl-4,9-cyclo-9,10-secocholest-5-en-24-yl β-D-glucopyranosyl-(1->2)-[D-glucopyranosyl-(1->6)]-β-D-glucopyranoside |
| β-D-Glucopyranoside, (1R,4R)-4-[(3β,9β,10α,11α)-3,11-dihydroxy-4,4,9,14-tetramethylestr-5-en-17-yl]-1-(1-hydroxy-1-methylethyl)pentyl O-β-D-glucopyranosyl-(1->2)-O-[D-glucopyranosy 
l-(1->6)]- |
| Mogroside III-A1 |
| MOGROSIDE III A1 |
| β-D-Glucopyranoside, (1R,4R)-4-[(3β,9β,10α,11α,17β)-3,11-dihydroxy-4,4,9,14-tetramethylestr-5-en-17-yl]-1-(1-hydroxy-1-methylethyl)pentyl O-β-D-glucopyranosyl-(1->2)-O-[β-D-g lucopyranosyl-(1->6)]- |