Histone H1-derived Peptide
Modify Date: 2024-01-06 18:47:41
Histone H1-derived Peptide structure
|
Common Name | Histone H1-derived Peptide | ||
|---|---|---|---|---|
| CAS Number | 889112-06-5 | Molecular Weight | 1252.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C56H101N17O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Histone H1-derived PeptideHistone H1-derived Peptide is a phosphopeptide and the peptide substrates containes a sequence in accordance with the optimal recognition motif for CDKs[1]. |
| Name | Histone H1-derived Peptide |
|---|
| Description | Histone H1-derived Peptide is a phosphopeptide and the peptide substrates containes a sequence in accordance with the optimal recognition motif for CDKs[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C56H101N17O15 |
|---|---|
| Molecular Weight | 1252.51 |
| InChIKey | MLODEUSVVAOABW-PNNPTOSWSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(C)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C1CCCN1C(=O)C(NC(=O)C(C)NC(=O)C1CCCN1C(=O)CNC(=O)CNC(=O)CN)C(C)O)C(=O)O |