1-Bromo-4-chloro-2-nitrobenzene structure
|
Common Name | 1-Bromo-4-chloro-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 41513-04-6 | Molecular Weight | 236.451 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 242.5±20.0 °C at 760 mmHg | |
| Molecular Formula | C6H3BrClNO2 | Melting Point | 67-70 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 100.5±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Bromo-5-chloronitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 242.5±20.0 °C at 760 mmHg |
| Melting Point | 67-70 °C(lit.) |
| Molecular Formula | C6H3BrClNO2 |
| Molecular Weight | 236.451 |
| Flash Point | 100.5±21.8 °C |
| Exact Mass | 234.903564 |
| PSA | 45.82000 |
| LogP | 3.15 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | UKTIMFAJRPSNGR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1Br |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,Xn |
| Risk Phrases | R20/21/22;R33;R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2904909090 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-chloro-6-bromonitrobenzene |
| EINECS 255-421-4 |
| Benzene, 1-bromo-4-chloro-2-nitro- |
| 1-Bromo-4-chloro-2-nitrobenzene |
| MFCD00024320 |
| 2-Bromo-5-Chloronitrobenzene |