2-IODO-4-NITROPHENOL structure
|
Common Name | 2-IODO-4-NITROPHENOL | ||
|---|---|---|---|---|
| CAS Number | 89487-91-2 | Molecular Weight | 265.00500 | |
| Density | 2.176 g/cm3 | Boiling Point | 294.5ºC at 760 mmHg | |
| Molecular Formula | C6H4INO3 | Melting Point | 89-94 °C | |
| MSDS | Chinese USA | Flash Point | 131.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Iodo-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.176 g/cm3 |
|---|---|
| Boiling Point | 294.5ºC at 760 mmHg |
| Melting Point | 89-94 °C |
| Molecular Formula | C6H4INO3 |
| Molecular Weight | 265.00500 |
| Flash Point | 131.9ºC |
| Exact Mass | 264.92400 |
| PSA | 66.05000 |
| LogP | 2.42820 |
| Index of Refraction | 1.71 |
| InChIKey | BKQFOYCEUMVWOW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c(I)c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| HS Code | 2908999090 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-iodo-4-nitrophenol |