Trifarotene structure
|
Common Name | Trifarotene | ||
|---|---|---|---|---|
| CAS Number | 895542-09-3 | Molecular Weight | 459.577 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 641.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C29H33NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.0±31.5 °C | |
Use of TrifaroteneTrifarotene is a retinoic acid receptor (RAR) agonist with Kdapp of 2, 15 and 500 nM for RARγ, RARβ and RARα, respectively. |
| Name | 4-[3-(3-tert-butyl-4-pyrrolidin-1-ylphenyl)-4-(2-hydroxyethoxy)phenyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Trifarotene is a retinoic acid receptor (RAR) agonist with Kdapp of 2, 15 and 500 nM for RARγ, RARβ and RARα, respectively. |
|---|---|
| Related Catalog | |
| Target |
Kdapp: 2 nM (RARγ), 15 nM (RARβ), 500 nM (RARα)[1] |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 641.9±55.0 °C at 760 mmHg |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.577 |
| Flash Point | 342.0±31.5 °C |
| Exact Mass | 459.240967 |
| PSA | 70.00000 |
| LogP | 6.27 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | MFBCDACCJCDGBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2OCCO)ccc1N1CCCC1 |
| Storage condition | 2-8℃ |
| 4'-(2-Hydroxyethoxy)-3''-(2-methyl-2-propanyl)-4''-(1-pyrrolidinyl)-1,1':3',1''-terphenyl-4-carboxylic acid |
| [1,1':3',1''-Terphenyl]-4-carboxylic acid, 3''-(1,1-dimethylethyl)-4'-(2-hydroxyethoxy)-4''-(1-pyrrolidinyl)- |
| Trifarotene |
| CD5789 |
| UNII-0J8RN2W0HK |