5-chloro-1-ethyl-3-pyrazin-2-ylbenzimidazol-2-one structure
|
Common Name | 5-chloro-1-ethyl-3-pyrazin-2-ylbenzimidazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 89659-99-4 | Molecular Weight | 274.70600 | |
| Density | 1.392g/cm3 | Boiling Point | 447.1ºC at 760 mmHg | |
| Molecular Formula | C13H11ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.2ºC | |
| Name | 5-chloro-1-ethyl-3-pyrazin-2-ylbenzimidazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 447.1ºC at 760 mmHg |
| Molecular Formula | C13H11ClN4O |
| Molecular Weight | 274.70600 |
| Flash Point | 224.2ºC |
| Exact Mass | 274.06200 |
| PSA | 52.71000 |
| LogP | 2.25550 |
| Index of Refraction | 1.642 |
| InChIKey | VQIBUDLTSQDZEN-UHFFFAOYSA-N |
| SMILES | CCn1c(=O)n(-c2cnccn2)c2cc(Cl)ccc21 |
|
~33%
5-chloro-1-ethy... CAS#:89659-99-4 |
| Literature: Bianchi; Butti; Rossi; et al. European Journal of Medicinal Chemistry, 1983 , vol. 18, # 6 p. 495 - 500 |
| 2H-Benzimidazol-2-one,1,3-dihydro-5-chloro-1-ethyl-3-pyrazinyl |
| 1,3-Dihydro-5-chloro-1-ethyl-3-pyrazinyl-2H-benzimidazol-2-one |