(2α,3α)-2,3,24-Trihydroxyurs-12-en-28-oic acid structure
|
Common Name | (2α,3α)-2,3,24-Trihydroxyurs-12-en-28-oic acid | ||
|---|---|---|---|---|
| CAS Number | 89786-83-4 | Molecular Weight | 488.699 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 609.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.4±28.0 °C | |
Use of (2α,3α)-2,3,24-Trihydroxyurs-12-en-28-oic acidPygenic acid B is a triterpenoid that can be isolated from the leaves of Glochidion obliquum. Pygenic acid B shows antifungal activity against C. musae. Pygenic acid B shows ONOO- scavenging activity[1][2][3]. |
| Name | 2,3,24-Trihydroxy-12-ursen-28-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Pygenic acid B is a triterpenoid that can be isolated from the leaves of Glochidion obliquum. Pygenic acid B shows antifungal activity against C. musae. Pygenic acid B shows ONOO- scavenging activity[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 609.4±55.0 °C at 760 mmHg |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.699 |
| Flash Point | 336.4±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 6.46 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | JXSVIVRDWWRQRT-VULHWTOISA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1C |
| Hazard Codes | Xi |
|---|
| Urs-12-en-28-oic acid, 2,3,24-trihydroxy-, (2α,3α)- |
| (2α,3α)-2,3,24-Trihydroxyurs-12-en-28-oic acid |