Corosolic acid structure
|
Common Name | Corosolic acid | ||
|---|---|---|---|---|
| CAS Number | 52213-27-1 | Molecular Weight | 472.700 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 573.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.6±26.6 °C | |
Use of Corosolic acidPygenic acid A is a natural compound that can be found in Prunella vulgaris. Pygenic acid A induces apoptosis in metastatic breast cancer cells. Pygenic acid A can be used for the research of diabetes, inflammatory diseases, and cancers[1]. |
| Name | Pygenic acid A |
|---|---|
| Synonym | More Synonyms |
| Description | Pygenic acid A is a natural compound that can be found in Prunella vulgaris. Pygenic acid A induces apoptosis in metastatic breast cancer cells. Pygenic acid A can be used for the research of diabetes, inflammatory diseases, and cancers[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Pygenic acid A sensitizes metastatic breast cancer cells to anoikis via multiple pathways, such as inhibition of pro-survival pathways and activation of ER stress and autophagy, leading to the inhibition of metastasis[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.3±50.0 °C at 760 mmHg |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.700 |
| Flash Point | 314.6±26.6 °C |
| Exact Mass | 472.355255 |
| PSA | 77.76000 |
| LogP | 7.82 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | HFGSQOYIOKBQOW-NLKMMIFGSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(C)C5CCC43C)C2C1C |
| Hazard Codes | Xi |
|---|
| (2α,3α)-2,3-Dihydroxyurs-12-en-28-oic acid |
| Corosolic acid |
| Urs-12-en-28-oic acid, 2,3-dihydroxy-, (2α,3β)- |
| Urs-12-en-28-oic acid, 2,3-dihydroxy-, (2α,3α)- |
| 2,3-Dihydroxy-urs-12-en-28-oic acid |
| 2α-Hydroxyursolic acid |
| (2α,3β)-2,3-Dihydroxyurs-12-en-28-oic acid |