adrenocorticotropic hormone
adrenocorticotropic hormone structure
|
Common Name | adrenocorticotropic hormone | ||
|---|---|---|---|---|
| CAS Number | 9002-60-2 | Molecular Weight | 4541.07000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C207H308N56O58S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of adrenocorticotropic hormoneAdrenocorticotropic hormone (ACTH) is a polypeptide tropic hormone produced by the anterior pituitary gland. Adrenocorticotropic hormone regulates cortisol and androgen production[1][2]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | corticotropin |
|---|
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Adrenocorticotropic hormone (ACTH) is a polypeptide tropic hormone produced by the anterior pituitary gland. Adrenocorticotropic hormone regulates cortisol and androgen production[1][2]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C207H308N56O58S |
|---|---|
| Molecular Weight | 4541.07000 |
| Exact Mass | 4538.26000 |
| PSA | 1861.55000 |
| LogP | 5.65470 |
| Appearance of Characters | powder |
| InChIKey | IDLFZVILOHSSID-OVLDLUHVSA-N |
| SMILES | CSCCC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CO)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(=N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)NC(C(=O)NCC(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)N1CCCC1C(=O)NC(C(=O)NC(CCCCN)C(=O)NC(C(=O)NC(Cc1ccc(O)cc1)C(=O)N1CCCC1C(=O)NC(CC(N)=O)C(=O)NCC(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(CO)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(C)C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O)C(C)C)C(C)C)C(C)C |
| Storage condition | −20°C |
| Water Solubility | H2O: 1 mg/mL, clear, colorless |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 20/21/22-40 |
| Safety Phrases | 22-36 |
| WGK Germany | 3 |
| RTECS | GM7900000 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of corticotropin? |
| A: Molecular formula of corticotropin is C207H308N56O58S. |
| Q: What is the InChIKey of corticotropin? |
| A: InChIKey of corticotropin is IDLFZVILOHSSID-OVLDLUHVSA-N. |
| Q: What is the English name of corticotropin? |
| A: The English name of corticotropin is corticotropin. |
| Q: What are the uses of corticotropin? |
| A: Main uses of corticotropin: Adrenocorticotropic hormone (ACTH) is a polypeptide tropic hormone produced by the anterior pituitary gland. Adrenocorticotropic hormone regulates cortisol and androgen production[1][2]. |
| Q: What is the safety information for corticotropin? |
| A: Safety information for corticotropin: 22-36. |
| Q: What is the physical appearance of corticotropin? |
| A: corticotropin appears as powder. |
| Q: What is the molecular weight of corticotropin? |
| A: Molecular weight of corticotropin is 4541.07000. |
| Q: What are the storage conditions for corticotropin? |
| A: Storage conditions for corticotropin: −20°C. |
| Q: What is the polar surface area (PSA) of corticotropin? |
| A: Polar surface area (PSA) of corticotropin is 1861.55000. |
| Q: How is the water solubility of corticotropin? |
| A: Water solubility of corticotropin: H2O: 1 mg/mL, clear, colorless. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Henan Tianfu Chemical Co., Ltd. |