H-Pro-Thr-Glu-Phe-p-nitro-Phe-Arg-Leu-OH structure
|
Common Name | H-Pro-Thr-Glu-Phe-p-nitro-Phe-Arg-Leu-OH | ||
|---|---|---|---|---|
| CAS Number | 90331-82-1 | Molecular Weight | 954.04 | |
| Density | 1.45g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H63N11O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Pro-Thr-Glu-Phe-p-nitro-Phe-Arg-Leu-OHH-Pro-Thr-Glu-Phe-p-nitro-Phe-Arg-Leu-OH is a water-soluble polypeptide that can serve as a substrate for cathepsin D, pepsin and pepsinogen. H-Pro-Thr-Glu-Phe-p-nitro-Phe-Arg-Leu-OH has potential applications in biochemical analysis[1][2]. |
| Name | h-pro-thr-glu-phe-p-nitro-phe-arg-leu-oh |
|---|
| Description | H-Pro-Thr-Glu-Phe-p-nitro-Phe-Arg-Leu-OH is a water-soluble polypeptide that can serve as a substrate for cathepsin D, pepsin and pepsinogen. H-Pro-Thr-Glu-Phe-p-nitro-Phe-Arg-Leu-OH has potential applications in biochemical analysis[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.45g/cm3 |
|---|---|
| Molecular Formula | C44H63N11O13 |
| Molecular Weight | 954.04 |
| Exact Mass | 953.46100 |
| PSA | 389.18000 |
| LogP | 3.06870 |
| Index of Refraction | 1.653 |
| InChIKey | OHIZVORKJVKXKL-RLEGQPMYSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1ccc([N+](=O)[O-])cc1)NC(=O)C(Cc1ccccc1)NC(=O)C(CCC(=O)O)NC(=O)C(NC(=O)C1CCCN1)C(C)O)C(=O)O |