7-Xylosyl-10-deacetyltaxol B structure
|
Common Name | 7-Xylosyl-10-deacetyltaxol B | ||
|---|---|---|---|---|
| CAS Number | 90332-64-2 | Molecular Weight | 921.97900 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1041.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C48H59NO17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 583.5±34.3 °C | |
Use of 7-Xylosyl-10-deacetyltaxol B7-Xylosyl-10-Deacetyltaxol B (7-xylosyl-10-Deacetylpaclitaxel B) is a paclitaxel derivative derived from T. cuspidate. 7-Xylosyl-10-Deacetyltaxol B has anti-tumor activity and inhibits the growth of S180 sarcoma[1]. |
| Name | (2α,5β,7β,10β,13α)-4-Acetoxy-1,10-dihydroxy-13-{[(2R,3S)-2-hydroxy-3-{[(2E)-2-methyl-2-butenoyl]amino}-3-phenylpropanoyl]oxy}-9-oxo-7-(β-D-xylopyranosyloxy)-5,20-epoxytax-11-en-2-yl benzoate |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Xylosyl-10-Deacetyltaxol B (7-xylosyl-10-Deacetylpaclitaxel B) is a paclitaxel derivative derived from T. cuspidate. 7-Xylosyl-10-Deacetyltaxol B has anti-tumor activity and inhibits the growth of S180 sarcoma[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1041.3±65.0 °C at 760 mmHg |
| Molecular Formula | C48H59NO17 |
| Molecular Weight | 921.97900 |
| Flash Point | 583.5±34.3 °C |
| Exact Mass | 921.37800 |
| PSA | 274.14000 |
| LogP | 6.39 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | YAOWLIDDDUBAEI-ZVZSAYPQSA-N |
| SMILES | CC=C(C)C(=O)NC(c1ccccc1)C(O)C(=O)OC1CC2(O)C(OC(=O)c3ccccc3)C3C4(OC(C)=O)COC4CC(OC4OCC(O)C(O)C4O)C3(C)C(=O)C(O)C(=C1C)C2(C)C |
| Hazard Codes | Xi |
|---|
| Benzenepropanoic acid, α-hydroxy-β-[[(2E)-2-methyl-1-oxo-2-buten-1-yl]amino]-, (2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS)-12b-(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro- 6,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-4-(β-D-xylopyranosyloxy)-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester, (αR,βS)- |
| (2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS)-12b-acetoxy-6,11-dihydroxy-9-(((2R,3S)-2-hydroxy-3-((E)-2-methylbut-2-enamido)-3-phenylpropanoyl)oxy)-4a,8,13,13-tetramethyl-5-oxo-4-(((2S,3R,4S,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)oxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-1H-7,11-methanocyclodeca[3,4]benzo[1,2-b]oxet-12-yl benzoate |
| (2α,5β,7β,10β,13α)-4-Acetoxy-1,10-dihydroxy-13-{[(2R,3S)-2-hydroxy-3-{[(2E)-2-methyl-2-butenoyl]amino}-3-phenylpropanoyl]oxy}-9-oxo-7-(β-D-xylopyranosyloxy)-5,20-epoxytax-11-en-2-y l benzoate |