7-Epi-10-deacetyltaxol structure
|
Common Name | 7-Epi-10-deacetyltaxol | ||
|---|---|---|---|---|
| CAS Number | 78454-17-8 | Molecular Weight | 811.86900 | |
| Density | 1.41±0.1 g/cm3 (20 ºC 760 Torr) | Boiling Point | 959.5℃ at 760 mmHg | |
| Molecular Formula | C45H49NO13 | Melting Point | 163-170?C | |
| MSDS | N/A | Flash Point | N/A | |
Use of 7-Epi-10-deacetyltaxol7-Epi 10-desacetyl paclitaxel (7-epi-10-deacetyltaxol), a taxol derivative, exhibits cytotoxicity against HeLa cells with an IC50 of 85 μM[1][2]. |
| Name | 10-deacetyltaxol |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Epi 10-desacetyl paclitaxel (7-epi-10-deacetyltaxol), a taxol derivative, exhibits cytotoxicity against HeLa cells with an IC50 of 85 μM[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.41±0.1 g/cm3 (20 ºC 760 Torr) |
|---|---|
| Boiling Point | 959.5℃ at 760 mmHg |
| Melting Point | 163-170?C |
| Molecular Formula | C45H49NO13 |
| Molecular Weight | 811.86900 |
| Exact Mass | 811.32000 |
| PSA | 218.71000 |
| LogP | 3.73970 |
| InChIKey | TYLVGQKNNUHXIP-DIYBZAJCSA-N |
| SMILES | CC(=O)OC12COC1CC(O)C1(C)C(=O)C(O)C3=C(C)C(OC(=O)C(O)C(NC(=O)c4ccccc4)c4ccccc4)CC(O)(C(OC(=O)c4ccccc4)C21)C3(C)C |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
| Water Solubility | Insuluble (2.4E-4 g/L) (25 ºC) |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| Ormosin VI |
| 10-Desacetyl-7-epipaclitaxel |
| 10-Deacetyl-7-epi-taxol |
| 7-Epi-10-deacetyltaxol |
| 7-Epi 10-Desacetyl Paclitaxel |
| CS-1143 |
| 10-Deacetyl-7-epi-paclitaxel |
| 7-Epi-10-deacetyl-taxol |