Azide-PEG6-Tos
Modify Date: 2025-08-27 19:14:35
Azide-PEG6-Tos structure
|
Common Name | Azide-PEG6-Tos | ||
|---|---|---|---|---|
| CAS Number | 906007-10-1 | Molecular Weight | 461.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H31N3O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azide-PEG6-TosAzide-PEG6-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azide-PEG6-Tos |
|---|
| Description | Azide-PEG6-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H31N3O8S |
|---|---|
| Molecular Weight | 461.53 |
| InChIKey | DZQISMWOKQMODJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCN=[N+]=[N-])cc1 |