Collagen structure
|
Common Name | Collagen | ||
|---|---|---|---|---|
| CAS Number | 9064-67-9 | Molecular Weight | 300.354 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 614.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C4H6N2O3R2.(C7H9N2O2R)n | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 325.7±31.5 °C | |
| Name | Collagen |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 614.9±55.0 °C at 760 mmHg |
| Molecular Formula | C4H6N2O3R2.(C7H9N2O2R)n |
| Molecular Weight | 300.354 |
| Flash Point | 325.7±31.5 °C |
| Exact Mass | 300.179749 |
| LogP | -1.42 |
| Appearance of Characters | solution |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | WCTSASYOBIDUQP-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(=O)CNC(=O)C1CCCN1C(=O)C(CCC(=O)O)NC(=O)CN)C(=O)NC(C)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)NC(CCC(N)=O)C(=O)NCC(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)O |
| Storage condition | 2-8°C |
| Water Solubility | H2O: 5 mg/mL, hazy, colorless and viscous |
| Hazard Codes | B |
|---|---|
| WGK Germany | 1 |
| cellagen(tm) solution with dmem |
| cellagen(tm) solution pc-3 |
| cellagen(tm) beads |
| cellagen(tm) solution pc-5 |
| cellagen(tm) solution emem |
| cellagen(tm) solution t-iv |
| Alanine, N-(2-aminopropyl)glycyl-L-prolyl- |
| N-(2-Aminopropyl)glycyl-L-prolylalanine |
| cellagen(tm) solution ac-5 |
| cellagen(tm) solution ac-3 |