T3 Acyl glucuronide structure
|
Common Name | T3 Acyl glucuronide | ||
|---|---|---|---|---|
| CAS Number | 910907-23-2 | Molecular Weight | 827.09800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20I3NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of T3 Acyl glucuronideT3 Acyl glucuronide, an endogenous metabolite, is the acyl glucuronide formation of triiodothyronine (T3)[1]. |
| Name | (2S,3S,4S,5R,6S)-6-[(2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | T3 Acyl glucuronide, an endogenous metabolite, is the acyl glucuronide formation of triiodothyronine (T3)[1]. |
|---|---|
| Related Catalog | |
| Target |
Endogenous metabolite[1] |
| In Vitro | T3 Acyl glucuronide is a metabolite of T3 glucuronides after hydrolysis with β-glucuronidase[1]. |
| References |
| Molecular Formula | C21H20I3NO10 |
|---|---|
| Molecular Weight | 827.09800 |
| Exact Mass | 826.82200 |
| PSA | 189.00000 |
| LogP | 2.00380 |
| InChIKey | LQMBVWCQWFEPFK-UHFFFAOYSA-N |
| SMILES | NC(Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)OC1OC(C(=O)O)C(O)C(O)C1O |
| Triiodothyronine Acyl Glucuronide |
| T3 Acyl Glucuronide |
| Liothyronine Acyl Glucuronide |
| 3,3',5-Triiodo-L-thyronine Acyl |A-D-Glucuronide |