5-Bromo-2-methyl-3-nitropyridine structure
|
Common Name | 5-Bromo-2-methyl-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 911434-05-4 | Molecular Weight | 217.020 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 252.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BrN2O2 | Melting Point | 38.0 to 42.0 °C | |
| MSDS | N/A | Flash Point | 106.6±25.9 °C | |
| Name | 5-Bromo-2-methyl-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 252.6±35.0 °C at 760 mmHg |
| Melting Point | 38.0 to 42.0 °C |
| Molecular Formula | C6H5BrN2O2 |
| Molecular Weight | 217.020 |
| Flash Point | 106.6±25.9 °C |
| Exact Mass | 215.953430 |
| PSA | 58.71000 |
| LogP | 1.85 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | FZZLWWNOYMHSIS-UHFFFAOYSA-N |
| SMILES | Cc1ncc(Br)cc1[N+](=O)[O-] |
| Storage condition | Room temperature. |
|
~98%
5-Bromo-2-methy... CAS#:911434-05-4 |
| Literature: ASTRAZENECA AB Patent: US2008/194552 A1, 2008 ; Location in patent: Page/Page column 40 ; US 20080194552 A1 |
|
~62%
5-Bromo-2-methy... CAS#:911434-05-4 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2008/157191 A2, 2008 ; Location in patent: Page/Page column 83-84 ; WO 2008/157191 A2 |
|
~%
5-Bromo-2-methy... CAS#:911434-05-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 54, # 6 p. 1789 - 1811 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-3-nitro-α-picoline |
| T6NJ B1 CNW EE |
| 5-bromo-2-methyl-3-nitro-pyridine |
| 5-Bromo-2-methyl-3-nitropyridine |
| 5-Bromo-3-nitro-2-picoline |
| Pyridine, 5-bromo-2-methyl-3-nitro- |
| 5-BROMO-3-NITROPICOLINE |