Enniatin B structure
|
Common Name | Enniatin B | ||
|---|---|---|---|---|
| CAS Number | 917-13-5 | Molecular Weight | 639.820 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 827.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C33H57N3O9 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 454.0±34.3 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of Enniatin BEnniatin B is a Fusarium mycotoxin. Enniatin B inhibits acyl-CoA: cholesterol acyltransferase (ACAT) activity with an IC50 of 113 μM in an enzyme assay using rat liver microsomes[1]. Enniatins B decreases the activation of ERK (p44/p42)[2]. |
| Name | enniatin B |
|---|---|
| Synonym | More Synonyms |
| Description | Enniatin B is a Fusarium mycotoxin. Enniatin B inhibits acyl-CoA: cholesterol acyltransferase (ACAT) activity with an IC50 of 113 μM in an enzyme assay using rat liver microsomes[1]. Enniatins B decreases the activation of ERK (p44/p42)[2]. |
|---|---|
| Related Catalog | |
| Target |
ACAT ERK |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 827.0±65.0 °C at 760 mmHg |
| Molecular Formula | C33H57N3O9 |
| Molecular Weight | 639.820 |
| Flash Point | 454.0±34.3 °C |
| Exact Mass | 639.409485 |
| PSA | 139.83000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.460 |
| InChIKey | MIZMDSVSLSIMSC-VYLWARHZSA-N |
| SMILES | CC(C)C1OC(=O)C(C(C)C)N(C)C(=O)C(C(C)C)OC(=O)C(C(C)C)N(C)C(=O)C(C(C)C)OC(=O)C(C(C)C)N(C)C1=O |
| Storage condition | ?20°C |
| Water Solubility | DMSO: soluble10mg/mL |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H331 |
| Precautionary Statements | P261-P280-P301 + P310-P311 |
| Hazard Codes | T |
| Risk Phrases | 23/24/25 |
| Safety Phrases | 45 |
| RIDADR | UN 2811 |
| Packaging Group | I |
| Hazard Class | 6.1(a) |
|
An investigation of the endocrine disrupting potential of enniatin B using in vitro bioassays.
Toxicol. Lett. , doi:10.1016/j.toxlet.2015.01.014, (2015) Evidence that some of the fungal metabolites present in food and feed may act as potential endocrine disruptors is increasing. Enniatin B (ENN B) is among the emerging Fusarium mycotoxins known to con... |
| enniatin b |
| 1,7,13-Trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone, 4,10,16-trimethyl-3,6,9,12,15,18-hexakis(1-methylethyl)-, (3S,6R,9S,12R,15S,18R)- |
| (3S,6R,9S,12R,15S,18R)-3,6,9,12,15,18-Hexaisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |