Pyridine, 4-[5-[[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]thio]-1,3,4-oxadiazol-2-yl] structure
|
Common Name | Pyridine, 4-[5-[[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]thio]-1,3,4-oxadiazol-2-yl] | ||
|---|---|---|---|---|
| CAS Number | 919936-70-2 | Molecular Weight | 337.35600 | |
| Density | 1.47±0.1 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 572.5±60.0 °C (760 mmHg) | |
| Molecular Formula | C16H11N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pyridine, 4-[5-[[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]thio]-1,3,4-oxadiazol-2-yl]GS87 is a highly specific and potent GSK3 inhibitor with IC50s of 415nM and 521nM for GSK3α and GSK3β, respectively. GS87 induces differentiation of acute myeloid leukemia (AML) cell lines by effectively activating GSK3-dependent signaling components including MAPK signaling. GS87 modulates key GSK3 target proteins involved in cell proliferation and differentiation more effectively than Lithium and SB415285 (SB). GS87 has the potential for acting as a differentiation agent for non-promyelocytic AML research[1]. |
| Name | Pyridine, 4-[5-[[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]thio]-1,3,4-oxadiazol-2-yl] |
|---|---|
| Synonym | More Synonyms |
| Description | GS87 is a highly specific and potent GSK3 inhibitor with IC50s of 415nM and 521nM for GSK3α and GSK3β, respectively. GS87 induces differentiation of acute myeloid leukemia (AML) cell lines by effectively activating GSK3-dependent signaling components including MAPK signaling. GS87 modulates key GSK3 target proteins involved in cell proliferation and differentiation more effectively than Lithium and SB415285 (SB). GS87 has the potential for acting as a differentiation agent for non-promyelocytic AML research[1]. |
|---|---|
| Related Catalog | |
| Target |
GSK3α:415 nM (IC50) GSK3β:521 nM (IC50) |
| References |
| Density | 1.47±0.1 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 572.5±60.0 °C (760 mmHg) |
| Molecular Formula | C16H11N5O2S |
| Molecular Weight | 337.35600 |
| Exact Mass | 337.06300 |
| PSA | 116.03000 |
| LogP | 3.47390 |
| InChIKey | HNTUWEZDVRVSFY-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2noc(CSc3nnc(-c4ccncc4)o3)n2)cc1 |
| 4-(5-([(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl)-1,3,4-oxadiazol-2-yl)pyridine |