LYS-VAL HYDROCHLORIDE structure
|
Common Name | LYS-VAL HYDROCHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 92218-55-8 | Molecular Weight | 281.78000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H24ClN3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of LYS-VAL HYDROCHLORIDE(S)-2-((S)-2,6-Diaminohexanamido)-3-methylbutanoic acid hydrochloride is a valine derivative[1]. |
| Name | 2-(2,6-diaminohexanoylamino)-3-methylbutanoic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-2-((S)-2,6-Diaminohexanamido)-3-methylbutanoic acid hydrochloride is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Molecular Formula | C11H24ClN3O3 |
|---|---|
| Molecular Weight | 281.78000 |
| Exact Mass | 281.15100 |
| PSA | 121.93000 |
| LogP | 2.71100 |
| InChIKey | OKIYIEZRMCQJCX-OZZZDHQUSA-N |
| SMILES | CC(C)C(NC(=O)C(N)CCCCN)C(=O)O.Cl |
| RIDADR | NONH for all modes of transport |
|---|
|
X-ray studies on crystalline complexes involving amino acids and peptides. XV. Crystal structures of L-lysine D-glutamate and L-lysine D-aspartate monohydrate and the effect of chirality on molecular aggregation.
Int. J. Pept. Protein Res. 32 , 352-360, (1988) L-Lysine D-glutamate crystallizes in the monoclinic space group P2(1) with a = 4.902, b = 30.719, c = 9.679 A, beta = 90 degrees and Z = 4. The crystals of L-lysine D-aspartate monohydrate belong to t... |
|
|
Crystal and molecular structure of L-valyl-L-lysine hydrochloride.
Int. J. Pept. Protein Res. 38 , 569-573, (1991) L-Valyl-L-lysine hydrochloride, C11N3O3H23 HCl, crystallizes in the monoclinic space group P2(1) with a = 5.438(5), b = 14.188(5), c = 9.521(5) A, beta = 95.38(2) degrees and Z = 2. The crystal struct... |
|
|
Immuno-, phagocytosis-modulating and antitoxic properties of dipeptides are defined by the activity of their constituent amino acids.
Int. J. Immunopharmacol. 21 , 879-883, (1999) In experiments on mice and the influence in vitro of the dipeptides GluTrp, LysAsp, LysVal, AspGlu, GluAsp on their constituent amino acids and mixtures on the indexes of specific and non-specific res... |
| Lys-Val hydrochloride |