WY-507 structure
|
Common Name | WY-507 | ||
|---|---|---|---|---|
| CAS Number | 924069-79-4 | Molecular Weight | 225.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WY-507binders to the extra-domain B of fibronectin; class III antiarrhythmic agent; |
| Name | WY-507 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H19N |
|---|---|
| Molecular Weight | 225.33 |
| InChIKey | QCEFSYCYGIACAD-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(OCC(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1 |
| Benzonitrile, 4-[2-[4-(1,3-benzodioxol-5-ylmethyl)-1-piperazinyl]-2-oxoethoxy]- |