Sialyl Lewis A, Sodium Salt structure
|
Common Name | Sialyl Lewis A, Sodium Salt | ||
|---|---|---|---|---|
| CAS Number | 92448-22-1 | Molecular Weight | 820.74400 | |
| Density | 1.66g/cm3 | Boiling Point | 1285.8ºC at 760mmHg | |
| Molecular Formula | C31H52N2O23 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 731.4ºC | |
| Name | Sialyl Lewis A, Sodium Salt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 1285.8ºC at 760mmHg |
| Molecular Formula | C31H52N2O23 |
| Molecular Weight | 820.74400 |
| Flash Point | 731.4ºC |
| Exact Mass | 820.29600 |
| PSA | 402.87000 |
| Index of Refraction | 1.64 |
| InChIKey | INZOTETZQBPBCE-NYLDSJSYSA-N |
| SMILES | CC(=O)NC(C=O)C(OC1OC(CO)C(O)C(OC2(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O2)C1O)C(OC1OC(C)C(O)C(O)C1O)C(O)CO |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Feizi, T.
Curr. Opin. Struct. Biol. 3 , 701, (1993)
|
| sialyl lewis a, sodium salt |