Deschloro Atovaquone structure
|
Common Name | Deschloro Atovaquone | ||
|---|---|---|---|---|
| CAS Number | 92458-44-1 | Molecular Weight | 332.39200 | |
| Density | 1.279g/cm3 | Boiling Point | 513.812ºC at 760 mmHg | |
| Molecular Formula | C22H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.629ºC | |
| Name | 4-hydroxy-3-(4-phenylcyclohexyl)naphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 513.812ºC at 760 mmHg |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.39200 |
| Flash Point | 278.629ºC |
| Exact Mass | 332.14100 |
| PSA | 54.37000 |
| LogP | 4.85170 |
| Index of Refraction | 1.649 |
| InChIKey | BTUOKIGIZFBGRF-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1C1CCC(c2ccccc2)CC1 |
|
~%
Deschloro Atovaquone CAS#:92458-44-1 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 3177 |
|
~%
Deschloro Atovaquone CAS#:92458-44-1 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 3177 |
|
~%
Deschloro Atovaquone CAS#:92458-44-1 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 3177 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| trans-2-Hydroxy-3-(4-phenylcyclohexyl)-1,4-naphthalenedione |
| Deschloro Atovaquone |
| 2-hydroxy-3-(4t-phenyl-cyclohexyl-(r))-[1,4]naphthoquinone |
| 2-Hydroxy-3-(4t-phenyl-cyclohexyl-(r))-[1,4]naphthochinon |