Bis(2,2,2-trifluoroethyl) Phosphite structure
|
Common Name | Bis(2,2,2-trifluoroethyl) Phosphite | ||
|---|---|---|---|---|
| CAS Number | 92466-70-1 | Molecular Weight | 246.04500 | |
| Density | 1.545 g/mL at 25 °C(lit.) | Boiling Point | 43-44 °C2 mm Hg(lit.) | |
| Molecular Formula | C4H5F6O3P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 169 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Bis(2,2,2-trifluoroethyl) Phosphite |
|---|---|
| Synonym | More Synonyms |
| Density | 1.545 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 43-44 °C2 mm Hg(lit.) |
| Molecular Formula | C4H5F6O3P |
| Molecular Weight | 246.04500 |
| Flash Point | 169 °F |
| Exact Mass | 245.98800 |
| PSA | 59.00000 |
| LogP | 2.53390 |
| Appearance of Characters | Liquid |
| Index of Refraction | n20/D 1.332(lit.) |
| InChIKey | IMDCVAFSSZPRRM-UHFFFAOYSA-N |
| SMILES | O=[P+](OCC(F)(F)F)OCC(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 23-26-28-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2920909090 |
|
~91%
Bis(2,2,2-trifl... CAS#:92466-70-1 |
| Literature: Timperley; Waters Chemical Communications, 2001 , # 9 p. 797 - 798 |
|
~79%
Bis(2,2,2-trifl... CAS#:92466-70-1 |
| Literature: Gibbs, Don E.; Larsen, Catherine Synthesis, 1984 , # 5 p. 410 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Improved synthesis of bis (2, 2, 2-trifluoroethyl) phosphorochloridate. Bowman RA, et al.
Organic Prep. and Proc. Int. 31(2) , 230-31, (1999)
|
|
|
Bis [2, 2, 2-trifluoroethyl] phosphite, a new reagent for synthesizing mono-and diesters of phosphorous acid. Gibbs DE and Larsen C.
Synthesis 5 , 410-13, (1984)
|
| MFCD00063314 |
| Bis(2,2,2-trifluoroethyl) phosphite |